C17H19ClN2 — CID 45266048
2-(5-phenyl-3-pyridinyl)-7-azabicyclo[2.2.1]heptane;hydrochloride (PubChem CID 45266048) has the molecular formula C17H19ClN2 and a molecular weight of 286.81 g/mol. Its IUPAC name is 2-(5-phenyl-3-pyridinyl)-7-azabicyclo[2.2.1]heptane;hydrochloride.
| Compound Name | 2-(5-phenyl-3-pyridinyl)-7-azabicyclo[2.2.1]heptane;hydrochloride |
|---|---|
| PubChem CID | 45266048 |
| Molecular Formula | C17H19ClN2 |
| Molecular Weight | 286.81 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 2-(5-phenyl-3-pyridinyl)-7-azabicyclo[2.2.1]heptane;hydrochloride |
| SMILES | Cl.c1ccc(-c2cncc(C3CC4CCC3N4)c2)cc1 |
| InChI | InChI=1S/C17H18N2.ClH/c1-2-4-12(5-3-1)13-8-14(11-18-10-13)16-9-15-6-7-17(16)19-15;/h1-5,8,10-11,15-17,19H,6-7,9H2;1H |
| InChIKey | VLGMCAYHSZJZQX-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.81 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |