C17H17ClF2N2 — CID 45266019
2-[6-fluoro-5-(4-fluorophenyl)-3-pyridinyl]-7-azabicyclo[2.2.1]heptane;hydrochloride (PubChem CID 45266019) has the molecular formula C17H17ClF2N2 and a molecular weight of 322.79 g/mol. Its IUPAC name is 2-[6-fluoro-5-(4-fluorophenyl)-3-pyridinyl]-7-azabicyclo[2.2.1]heptane;hydrochloride.
| Compound Name | 2-[6-fluoro-5-(4-fluorophenyl)-3-pyridinyl]-7-azabicyclo[2.2.1]heptane;hydrochloride |
|---|---|
| PubChem CID | 45266019 |
| Molecular Formula | C17H17ClF2N2 |
| Molecular Weight | 322.79 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 2-[6-fluoro-5-(4-fluorophenyl)-3-pyridinyl]-7-azabicyclo[2.2.1]heptane;hydrochloride |
| SMILES | Cl.Fc1ccc(-c2cc(C3CC4CCC3N4)cnc2F)cc1 |
| InChI | InChI=1S/C17H16F2N2.ClH/c18-12-3-1-10(2-4-12)15-7-11(9-20-17(15)19)14-8-13-5-6-16(14)21-13;/h1-4,7,9,13-14,16,21H,5-6,8H2;1H |
| InChIKey | QMXPMNLVRZNSJZ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.79 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|