C6H3ClF6S — CID 118311397
chloro-(3,4-difluorophenyl)-tetrafluoro-λ6-sulfane (PubChem CID 118311397) has the molecular formula C6H3ClF6S and a molecular weight of 256.60 g/mol. Its IUPAC name is chloro-(3,4-difluorophenyl)-tetrafluoro-λ6-sulfane.
| Compound Name | chloro-(3,4-difluorophenyl)-tetrafluoro-λ6-sulfane |
|---|---|
| PubChem CID | 118311397 |
| Molecular Formula | C6H3ClF6S |
| Molecular Weight | 256.60 g/mol |
| Exact Mass | 255.95 |
| IUPAC Name | chloro-(3,4-difluorophenyl)-tetrafluoro-λ6-sulfane |
| SMILES | Fc1ccc(S(F)(F)(F)(F)Cl)cc1F |
| InChI | InChI=1S/C6H3ClF6S/c7-14(10,11,12,13)4-1-2-5(8)6(9)3-4/h1-3H |
| InChIKey | YLTPLHKVRQTJKY-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.60 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |