C19H21F4N5O — CID 118326730
N-[3-[(2R,5R)-6-amino-3,3,5-trifluoro-2,5-dimethyl-4H-pyridin-2-yl]-2-fluorophenyl]-1,4-dimethylimidazole-2-carboxamide (PubChem CID 118326730) has the molecular formula C19H21F4N5O and a molecular weight of 411.40 g/mol. Its IUPAC name is N-[3-[(2R,5R)-6-amino-3,3,5-trifluoro-2,5-dimethyl-4H-pyridin-2-yl]-2-fluorophenyl]-1,4-dimethylimidazole-2-carboxamide.
| Compound Name | N-[3-[(2R,5R)-6-amino-3,3,5-trifluoro-2,5-dimethyl-4H-pyridin-2-yl]-2-fluorophenyl]-1,4-dimethylimidazole-2-carboxamide |
|---|---|
| PubChem CID | 118326730 |
| Molecular Formula | C19H21F4N5O |
| Molecular Weight | 411.40 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | N-[3-[(2R,5R)-6-amino-3,3,5-trifluoro-2,5-dimethyl-4H-pyridin-2-yl]-2-fluorophenyl]-1,4-dimethylimidazole-2-carboxamide |
| SMILES | Cc1cn(C)c(C(=O)Nc2cccc([C@@]3(C)N=C(N)[C@](C)(F)CC3(F)F)c2F)n1 |
| InChI | InChI=1S/C19H21F4N5O/c1-10-8-28(4)14(25-10)15(29)26-12-7-5-6-11(13(12)20)18(3)19(22,23)9-17(2,21)16(24)27-18/h5-8H,9H2,1-4H3,(H2,24,27)(H,26,29)/t17-,18-/m1/s1 |
| InChIKey | PQPQOPLWTDFFNR-QZTJIDSGSA-N |
| XLogP | 3.46 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.40 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |