C22H19N7O2 — CID 118329857
9-(1H-indazol-5-yl)-1-piperidin-4-ylpyrimido[5,4-c][1,5]naphthyridine-2,4-dione (PubChem CID 118329857) has the molecular formula C22H19N7O2 and a molecular weight of 413.44 g/mol. Its IUPAC name is 9-(1H-indazol-5-yl)-1-piperidin-4-ylpyrimido[5,4-c][1,5]naphthyridine-2,4-dione.
| Compound Name | 9-(1H-indazol-5-yl)-1-piperidin-4-ylpyrimido[5,4-c][1,5]naphthyridine-2,4-dione |
|---|---|
| PubChem CID | 118329857 |
| Molecular Formula | C22H19N7O2 |
| Molecular Weight | 413.44 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | 9-(1H-indazol-5-yl)-1-piperidin-4-ylpyrimido[5,4-c][1,5]naphthyridine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(C2CCNCC2)c2c1cnc1ccc(-c3ccc4[nH]ncc4c3)nc12 |
| InChI | InChI=1S/C22H19N7O2/c30-21-15-11-24-18-4-3-16(12-1-2-17-13(9-12)10-25-28-17)26-19(18)20(15)29(22(31)27-21)14-5-7-23-8-6-14/h1-4,9-11,14,23H,5-8H2,(H,25,28)(H,27,30,31) |
| InChIKey | KYHQVRLSUIZLMG-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 121.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.44 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|