C16H21NO2S — CID 11833188
(2S,4Z)-2-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-2,3,6,7,8,9-hexahydrooxecin-10-one (PubChem CID 11833188) has the molecular formula C16H21NO2S and a molecular weight of 291.42 g/mol. Its IUPAC name is (2S,4Z)-2-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-2,3,6,7,8,9-hexahydrooxecin-10-one.
| Compound Name | (2S,4Z)-2-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-2,3,6,7,8,9-hexahydrooxecin-10-one |
|---|---|
| PubChem CID | 11833188 |
| Molecular Formula | C16H21NO2S |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | (2S,4Z)-2-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-2,3,6,7,8,9-hexahydrooxecin-10-one |
| SMILES | C/C(=C\c1csc(C)n1)[C@@H]1C/C=C\CCCCC(=O)O1 |
| InChI | InChI=1S/C16H21NO2S/c1-12(10-14-11-20-13(2)17-14)15-8-6-4-3-5-7-9-16(18)19-15/h4,6,10-11,15H,3,5,7-9H2,1-2H3/b6-4-,12-10+/t15-/m0/s1 |
| InChIKey | PXRHDFPSNJGIEI-SZVLQLAPSA-N |
| XLogP | 4.29 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|