C16H27NO3S — CID 118333700
prop-2-enyl 2-(3,3-dimethylbutylsulfanylcarbonyl)-2-methylpyrrolidine-1-carboxylate (PubChem CID 118333700) has the molecular formula C16H27NO3S and a molecular weight of 313.46 g/mol. Its IUPAC name is prop-2-enyl 2-(3,3-dimethylbutylsulfanylcarbonyl)-2-methylpyrrolidine-1-carboxylate.
| Compound Name | prop-2-enyl 2-(3,3-dimethylbutylsulfanylcarbonyl)-2-methylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 118333700 |
| Molecular Formula | C16H27NO3S |
| Molecular Weight | 313.46 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | prop-2-enyl 2-(3,3-dimethylbutylsulfanylcarbonyl)-2-methylpyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1CCCC1(C)C(=O)SCCC(C)(C)C |
| InChI | InChI=1S/C16H27NO3S/c1-6-11-20-14(19)17-10-7-8-16(17,5)13(18)21-12-9-15(2,3)4/h6H,1,7-12H2,2-5H3 |
| InChIKey | QJZVOYSBTLXATB-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.46 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|