C14H24NO7PS — CID 118333748
prop-2-enyl 2-(2-dimethoxyphosphoryloxyethylsulfanylcarbonyl)-2-methylpyrrolidine-1-carboxylate (PubChem CID 118333748) has the molecular formula C14H24NO7PS and a molecular weight of 381.39 g/mol. Its IUPAC name is prop-2-enyl 2-(2-dimethoxyphosphoryloxyethylsulfanylcarbonyl)-2-methylpyrrolidine-1-carboxylate.
| Compound Name | prop-2-enyl 2-(2-dimethoxyphosphoryloxyethylsulfanylcarbonyl)-2-methylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 118333748 |
| Molecular Formula | C14H24NO7PS |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | prop-2-enyl 2-(2-dimethoxyphosphoryloxyethylsulfanylcarbonyl)-2-methylpyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1CCCC1(C)C(=O)SCCOP(=O)(OC)OC |
| InChI | InChI=1S/C14H24NO7PS/c1-5-9-21-13(17)15-8-6-7-14(15,2)12(16)24-11-10-22-23(18,19-3)20-4/h5H,1,6-11H2,2-4H3 |
| InChIKey | GXCYTCSSVSNQQL-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|