C13H19NO4 — CID 167731695
7,7-dimethyl-1-prop-2-enoxycarbonyl-1-azaspiro[3.3]heptane-6-carboxylic acid (PubChem CID 167731695) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is 7,7-dimethyl-1-prop-2-enoxycarbonyl-1-azaspiro[3.3]heptane-6-carboxylic acid.
| Compound Name | 7,7-dimethyl-1-prop-2-enoxycarbonyl-1-azaspiro[3.3]heptane-6-carboxylic acid |
|---|---|
| PubChem CID | 167731695 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 7,7-dimethyl-1-prop-2-enoxycarbonyl-1-azaspiro[3.3]heptane-6-carboxylic acid |
| SMILES | C=CCOC(=O)N1CCC12CC(C(=O)O)C2(C)C |
| InChI | InChI=1S/C13H19NO4/c1-4-7-18-11(17)14-6-5-13(14)8-9(10(15)16)12(13,2)3/h4,9H,1,5-8H2,2-3H3,(H,15,16) |
| InChIKey | HYTTYVHQMLBPMC-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|