C11H17NO5 — CID 167721215
3-(3-methyl-1-prop-2-enoxycarbonylazetidin-3-yl)oxypropanoic acid (PubChem CID 167721215) has the molecular formula C11H17NO5 and a molecular weight of 243.26 g/mol. Its IUPAC name is 3-(3-methyl-1-prop-2-enoxycarbonylazetidin-3-yl)oxypropanoic acid.
| Compound Name | 3-(3-methyl-1-prop-2-enoxycarbonylazetidin-3-yl)oxypropanoic acid |
|---|---|
| PubChem CID | 167721215 |
| Molecular Formula | C11H17NO5 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 3-(3-methyl-1-prop-2-enoxycarbonylazetidin-3-yl)oxypropanoic acid |
| SMILES | C=CCOC(=O)N1CC(C)(OCCC(=O)O)C1 |
| InChI | InChI=1S/C11H17NO5/c1-3-5-16-10(15)12-7-11(2,8-12)17-6-4-9(13)14/h3H,1,4-8H2,2H3,(H,13,14) |
| InChIKey | LUKCUAKARJOALY-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|