C27H30FNO6S — CID 118336505
[(2S,3R,4S)-4-fluoro-5-methoxyimino-1,3-bis(phenylmethoxy)pentan-2-yl] 4-methylbenzenesulfonate (PubChem CID 118336505) has the molecular formula C27H30FNO6S and a molecular weight of 515.60 g/mol. Its IUPAC name is [(2S,3R,4S)-4-fluoro-5-methoxyimino-1,3-bis(phenylmethoxy)pentan-2-yl] 4-methylbenzenesulfonate.
| Compound Name | [(2S,3R,4S)-4-fluoro-5-methoxyimino-1,3-bis(phenylmethoxy)pentan-2-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 118336505 |
| Molecular Formula | C27H30FNO6S |
| Molecular Weight | 515.60 g/mol |
| Exact Mass | 515.18 |
| IUPAC Name | [(2S,3R,4S)-4-fluoro-5-methoxyimino-1,3-bis(phenylmethoxy)pentan-2-yl] 4-methylbenzenesulfonate |
| SMILES | CON=C[C@H](F)[C@H](OCc1ccccc1)[C@H](COCc1ccccc1)OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C27H30FNO6S/c1-21-13-15-24(16-14-21)36(30,31)35-26(20-33-18-22-9-5-3-6-10-22)27(25(28)17-29-32-2)34-19-23-11-7-4-8-12-23/h3-17,25-27H,18-20H2,1-2H3/t25-,26-,27-/m0/s1 |
| InChIKey | YTVOCKHYIYCVFK-QKDODKLFSA-N |
| XLogP | 4.84 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.60 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|