C34H37NO7S — CID 134972328
[(2R,3S,4S,5R)-6-hydroxyimino-3,4,5-tris(phenylmethoxy)hexan-2-yl] 4-methylbenzenesulfonate (PubChem CID 134972328) has the molecular formula C34H37NO7S and a molecular weight of 603.74 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-6-hydroxyimino-3,4,5-tris(phenylmethoxy)hexan-2-yl] 4-methylbenzenesulfonate.
| Compound Name | [(2R,3S,4S,5R)-6-hydroxyimino-3,4,5-tris(phenylmethoxy)hexan-2-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 134972328 |
| Molecular Formula | C34H37NO7S |
| Molecular Weight | 603.74 g/mol |
| Exact Mass | 603.23 |
| IUPAC Name | [(2R,3S,4S,5R)-6-hydroxyimino-3,4,5-tris(phenylmethoxy)hexan-2-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@H](C)[C@@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H](C=NO)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C34H37NO7S/c1-26-18-20-31(21-19-26)43(37,38)42-27(2)33(40-24-29-14-8-4-9-15-29)34(41-25-30-16-10-5-11-17-30)32(22-35-36)39-23-28-12-6-3-7-13-28/h3-22,27,32-34,36H,23-25H2,1-2H3/t27-,32-,33-,34+/m1/s1 |
| InChIKey | XDYBKHARYTZRKM-IUZPXUFISA-N |
| XLogP | 6.31 |
| TPSA | 103.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.74 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|