C29H35NO7S — CID 118109152
[(2R,3R,4S,5E)-5-methoxyimino-4-methyl-1,3,4-tris(phenylmethoxy)pentan-2-yl] methanesulfonate (PubChem CID 118109152) has the molecular formula C29H35NO7S and a molecular weight of 541.67 g/mol. Its IUPAC name is [(2R,3R,4S,5E)-5-methoxyimino-4-methyl-1,3,4-tris(phenylmethoxy)pentan-2-yl] methanesulfonate.
| Compound Name | [(2R,3R,4S,5E)-5-methoxyimino-4-methyl-1,3,4-tris(phenylmethoxy)pentan-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 118109152 |
| Molecular Formula | C29H35NO7S |
| Molecular Weight | 541.67 g/mol |
| Exact Mass | 541.21 |
| IUPAC Name | [(2R,3R,4S,5E)-5-methoxyimino-4-methyl-1,3,4-tris(phenylmethoxy)pentan-2-yl] methanesulfonate |
| SMILES | CO/N=C/[C@](C)(OCc1ccccc1)[C@H](OCc1ccccc1)[C@@H](COCc1ccccc1)OS(C)(=O)=O |
| InChI | InChI=1S/C29H35NO7S/c1-29(23-30-33-2,36-21-26-17-11-6-12-18-26)28(35-20-25-15-9-5-10-16-25)27(37-38(3,31)32)22-34-19-24-13-7-4-8-14-24/h4-18,23,27-28H,19-22H2,1-3H3/b30-23+/t27-,28-,29+/m1/s1 |
| InChIKey | AEHYCJUDANETTF-DNTFXYPOSA-N |
| XLogP | 4.74 |
| TPSA | 92.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.67 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|