C32H39NO8S — CID 134972298
[(2S,3S,4R)-5-(oxan-2-yloxyimino)-1,3,4-tris(phenylmethoxy)pentan-2-yl] methanesulfonate (PubChem CID 134972298) has the molecular formula C32H39NO8S and a molecular weight of 597.73 g/mol. Its IUPAC name is [(2S,3S,4R)-5-(oxan-2-yloxyimino)-1,3,4-tris(phenylmethoxy)pentan-2-yl] methanesulfonate.
| Compound Name | [(2S,3S,4R)-5-(oxan-2-yloxyimino)-1,3,4-tris(phenylmethoxy)pentan-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 134972298 |
| Molecular Formula | C32H39NO8S |
| Molecular Weight | 597.73 g/mol |
| Exact Mass | 597.24 |
| IUPAC Name | [(2S,3S,4R)-5-(oxan-2-yloxyimino)-1,3,4-tris(phenylmethoxy)pentan-2-yl] methanesulfonate |
| SMILES | CS(=O)(=O)O[C@@H](COCc1ccccc1)[C@@H](OCc1ccccc1)[C@@H](C=NOC1CCCCO1)OCc1ccccc1 |
| InChI | InChI=1S/C32H39NO8S/c1-42(34,35)41-30(25-36-22-26-13-5-2-6-14-26)32(39-24-28-17-9-4-10-18-28)29(38-23-27-15-7-3-8-16-27)21-33-40-31-19-11-12-20-37-31/h2-10,13-18,21,29-32H,11-12,19-20,22-25H2,1H3/t29-,30+,31?,32+/m1/s1 |
| InChIKey | DHOLQVTXIQCAFV-VWEBZXMGSA-N |
| XLogP | 5.25 |
| TPSA | 101.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.73 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|