C45H53NO7SSi2 — CID 134877647
[(2S,4R,5R)-5-[(1R,2E)-1-[tert-butyl(diphenyl)silyl]oxy-2-[tert-butyl(diphenyl)silyl]oxyiminoethyl]-2-phenyl-1,3-dioxolan-4-yl]methyl methanesulfonate (PubChem CID 134877647) has the molecular formula C45H53NO7SSi2 and a molecular weight of 808.16 g/mol. Its IUPAC name is [(2S,4R,5R)-5-[(1R,2E)-1-[tert-butyl(diphenyl)silyl]oxy-2-[tert-butyl(diphenyl)silyl]oxyiminoethyl]-2-phenyl-1,3-dioxolan-4-yl]methyl methanesulfonate.
| Compound Name | [(2S,4R,5R)-5-[(1R,2E)-1-[tert-butyl(diphenyl)silyl]oxy-2-[tert-butyl(diphenyl)silyl]oxyiminoethyl]-2-phenyl-1,3-dioxolan-4-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 134877647 |
| Molecular Formula | C45H53NO7SSi2 |
| Molecular Weight | 808.16 g/mol |
| Exact Mass | 807.31 |
| IUPAC Name | [(2S,4R,5R)-5-[(1R,2E)-1-[tert-butyl(diphenyl)silyl]oxy-2-[tert-butyl(diphenyl)silyl]oxyiminoethyl]-2-phenyl-1,3-dioxolan-4-yl]methyl methanesulfonate |
| SMILES | CC(C)(C)[Si](O/N=C/[C@@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H]1O[C@@H](c2ccccc2)O[C@@H]1COS(C)(=O)=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C45H53NO7SSi2/c1-44(2,3)55(36-25-15-9-16-26-36,37-27-17-10-18-28-37)52-40(42-41(34-49-54(7,47)48)50-43(51-42)35-23-13-8-14-24-35)33-46-53-56(45(4,5)6,38-29-19-11-20-30-38)39-31-21-12-22-32-39/h8-33,40-43H,34H2,1-7H3/b46-33+/t40-,41-,42+,43+/m1/s1 |
| InChIKey | LLILDUXKLVCVJP-BHIONIKNSA-N |
| XLogP | 6.95 |
| TPSA | 92.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.16 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|