C26H29NO5 — CID 134972445
(2R,3R,4S)-5-hydroxyimino-1,3,4-tris(phenylmethoxy)pentan-2-ol (PubChem CID 134972445) has the molecular formula C26H29NO5 and a molecular weight of 435.52 g/mol. Its IUPAC name is (2R,3R,4S)-5-hydroxyimino-1,3,4-tris(phenylmethoxy)pentan-2-ol.
| Compound Name | (2R,3R,4S)-5-hydroxyimino-1,3,4-tris(phenylmethoxy)pentan-2-ol |
|---|---|
| PubChem CID | 134972445 |
| Molecular Formula | C26H29NO5 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | (2R,3R,4S)-5-hydroxyimino-1,3,4-tris(phenylmethoxy)pentan-2-ol |
| SMILES | ON=C[C@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@H](O)COCc1ccccc1 |
| InChI | InChI=1S/C26H29NO5/c28-24(20-30-17-21-10-4-1-5-11-21)26(32-19-23-14-8-3-9-15-23)25(16-27-29)31-18-22-12-6-2-7-13-22/h1-16,24-26,28-29H,17-20H2/t24-,25+,26-/m1/s1 |
| InChIKey | AILMEHKZYKDQPG-UODIDJSMSA-N |
| XLogP | 4.19 |
| TPSA | 80.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|