C6H9N3O2 — CID 118338064
1-amino-5-ethylpyrimidine-2,4-dione (PubChem CID 118338064) has the molecular formula C6H9N3O2 and a molecular weight of 155.16 g/mol. Its IUPAC name is 1-amino-5-ethylpyrimidine-2,4-dione.
| Compound Name | 1-amino-5-ethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 118338064 |
| Molecular Formula | C6H9N3O2 |
| Molecular Weight | 155.16 g/mol |
| Exact Mass | 155.07 |
| IUPAC Name | 1-amino-5-ethylpyrimidine-2,4-dione |
| SMILES | CCc1cn(N)c(=O)[nH]c1=O |
| InChI | InChI=1S/C6H9N3O2/c1-2-4-3-9(7)6(11)8-5(4)10/h3H,2,7H2,1H3,(H,8,10,11) |
| InChIKey | JKYBYEWZXFICBP-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 80.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.16 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |