C22H30F2N2O4 — CID 118340957
[(2R,3S,5R)-5-(1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl)-2-(2,5-difluorophenyl)oxan-3-yl]-tert-butylcarbamic acid (PubChem CID 118340957) has the molecular formula C22H30F2N2O4 and a molecular weight of 424.49 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl)-2-(2,5-difluorophenyl)oxan-3-yl]-tert-butylcarbamic acid.
| Compound Name | [(2R,3S,5R)-5-(1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl)-2-(2,5-difluorophenyl)oxan-3-yl]-tert-butylcarbamic acid |
|---|---|
| PubChem CID | 118340957 |
| Molecular Formula | C22H30F2N2O4 |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | [(2R,3S,5R)-5-(1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl)-2-(2,5-difluorophenyl)oxan-3-yl]-tert-butylcarbamic acid |
| SMILES | CC(C)(C)N(C(=O)O)[C@H]1C[C@@H](N2CC3COCC3C2)CO[C@@H]1c1cc(F)ccc1F |
| InChI | InChI=1S/C22H30F2N2O4/c1-22(2,3)26(21(27)28)19-7-16(25-8-13-10-29-11-14(13)9-25)12-30-20(19)17-6-15(23)4-5-18(17)24/h4-6,13-14,16,19-20H,7-12H2,1-3H3,(H,27,28)/t13?,14?,16-,19+,20-/m1/s1 |
| InChIKey | BKCPAFNQXWMSML-KWSACRTNSA-N |
| XLogP | 3.52 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |