C30H22F3N5O2 — CID 118342408
methyl 6-cyano-2-(2,3,4-trifluoro-N-propan-2-ylanilino)-1H-indole-3-carboxylate;quinoline-8-carbonitrile (PubChem CID 118342408) has the molecular formula C30H22F3N5O2 and a molecular weight of 541.53 g/mol. Its IUPAC name is methyl 6-cyano-2-(2,3,4-trifluoro-N-propan-2-ylanilino)-1H-indole-3-carboxylate;quinoline-8-carbonitrile.
| Compound Name | methyl 6-cyano-2-(2,3,4-trifluoro-N-propan-2-ylanilino)-1H-indole-3-carboxylate;quinoline-8-carbonitrile |
|---|---|
| PubChem CID | 118342408 |
| Molecular Formula | C30H22F3N5O2 |
| Molecular Weight | 541.53 g/mol |
| Exact Mass | 541.17 |
| IUPAC Name | methyl 6-cyano-2-(2,3,4-trifluoro-N-propan-2-ylanilino)-1H-indole-3-carboxylate;quinoline-8-carbonitrile |
| SMILES | COC(=O)c1c(N(c2ccc(F)c(F)c2F)C(C)C)[nH]c2cc(C#N)ccc12.N#Cc1cccc2cccnc12 |
| InChI | InChI=1S/C20H16F3N3O2.C10H6N2/c1-10(2)26(15-7-6-13(21)17(22)18(15)23)19-16(20(27)28-3)12-5-4-11(9-24)8-14(12)25-19;11-7-9-4-1-3-8-5-2-6-12-10(8)9/h4-8,10,25H,1-3H3;1-6H |
| InChIKey | MSBUMSOKWWIOSL-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 105.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.53 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|