C20H16F3N3O2 — CID 159512119
carbon dioxide;3-methyl-2-(2,3,4-trifluoro-N-propan-2-ylanilino)-1H-indole-6-carbonitrile (PubChem CID 159512119) has the molecular formula C20H16F3N3O2 and a molecular weight of 387.36 g/mol. Its IUPAC name is carbon dioxide;3-methyl-2-(2,3,4-trifluoro-N-propan-2-ylanilino)-1H-indole-6-carbonitrile.
| Compound Name | carbon dioxide;3-methyl-2-(2,3,4-trifluoro-N-propan-2-ylanilino)-1H-indole-6-carbonitrile |
|---|---|
| PubChem CID | 159512119 |
| Molecular Formula | C20H16F3N3O2 |
| Molecular Weight | 387.36 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | carbon dioxide;3-methyl-2-(2,3,4-trifluoro-N-propan-2-ylanilino)-1H-indole-6-carbonitrile |
| SMILES | Cc1c(N(c2ccc(F)c(F)c2F)C(C)C)[nH]c2cc(C#N)ccc12.O=C=O |
| InChI | InChI=1S/C19H16F3N3.CO2/c1-10(2)25(16-7-6-14(20)17(21)18(16)22)19-11(3)13-5-4-12(9-23)8-15(13)24-19;2-1-3/h4-8,10,24H,1-3H3; |
| InChIKey | MASSREZNRGOHEE-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.36 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|