C20H17FIN3O2 — CID 118342648
methyl 6-cyano-2-(3-fluoro-4-iodo-N-propan-2-ylanilino)-1H-indole-3-carboxylate (PubChem CID 118342648) has the molecular formula C20H17FIN3O2 and a molecular weight of 477.28 g/mol. Its IUPAC name is methyl 6-cyano-2-(3-fluoro-4-iodo-N-propan-2-ylanilino)-1H-indole-3-carboxylate.
| Compound Name | methyl 6-cyano-2-(3-fluoro-4-iodo-N-propan-2-ylanilino)-1H-indole-3-carboxylate |
|---|---|
| PubChem CID | 118342648 |
| Molecular Formula | C20H17FIN3O2 |
| Molecular Weight | 477.28 g/mol |
| Exact Mass | 477.03 |
| IUPAC Name | methyl 6-cyano-2-(3-fluoro-4-iodo-N-propan-2-ylanilino)-1H-indole-3-carboxylate |
| SMILES | COC(=O)c1c(N(c2ccc(I)c(F)c2)C(C)C)[nH]c2cc(C#N)ccc12 |
| InChI | InChI=1S/C20H17FIN3O2/c1-11(2)25(13-5-7-16(22)15(21)9-13)19-18(20(26)27-3)14-6-4-12(10-23)8-17(14)24-19/h4-9,11,24H,1-3H3 |
| InChIKey | GKCVCROXIIMERR-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.28 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|