C22H20FN3O2 — CID 123977825
methyl 6-cyano-2-(N-cyclobutyl-3-fluoro-4-methylanilino)-1H-indole-3-carboxylate (PubChem CID 123977825) has the molecular formula C22H20FN3O2 and a molecular weight of 377.42 g/mol. Its IUPAC name is methyl 6-cyano-2-(N-cyclobutyl-3-fluoro-4-methylanilino)-1H-indole-3-carboxylate.
| Compound Name | methyl 6-cyano-2-(N-cyclobutyl-3-fluoro-4-methylanilino)-1H-indole-3-carboxylate |
|---|---|
| PubChem CID | 123977825 |
| Molecular Formula | C22H20FN3O2 |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | methyl 6-cyano-2-(N-cyclobutyl-3-fluoro-4-methylanilino)-1H-indole-3-carboxylate |
| SMILES | COC(=O)c1c(N(c2ccc(C)c(F)c2)C2CCC2)[nH]c2cc(C#N)ccc12 |
| InChI | InChI=1S/C22H20FN3O2/c1-13-6-8-16(11-18(13)23)26(15-4-3-5-15)21-20(22(27)28-2)17-9-7-14(12-24)10-19(17)25-21/h6-11,15,25H,3-5H2,1-2H3 |
| InChIKey | FZKXBZRNYUDPBD-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |