C43H47N5S2 — CID 118345859
2-[4-(4-methyl-2,5-dioctylphenyl)-6-(2-methylthieno[3,2-b]thiophen-5-yl)pyrimidin-2-yl]benzene-1,3,5-tricarbonitrile (PubChem CID 118345859) has the molecular formula C43H47N5S2 and a molecular weight of 698.02 g/mol. Its IUPAC name is 2-[4-(4-methyl-2,5-dioctylphenyl)-6-(2-methylthieno[3,2-b]thiophen-5-yl)pyrimidin-2-yl]benzene-1,3,5-tricarbonitrile.
| Compound Name | 2-[4-(4-methyl-2,5-dioctylphenyl)-6-(2-methylthieno[3,2-b]thiophen-5-yl)pyrimidin-2-yl]benzene-1,3,5-tricarbonitrile |
|---|---|
| PubChem CID | 118345859 |
| Molecular Formula | C43H47N5S2 |
| Molecular Weight | 698.02 g/mol |
| Exact Mass | 697.33 |
| IUPAC Name | 2-[4-(4-methyl-2,5-dioctylphenyl)-6-(2-methylthieno[3,2-b]thiophen-5-yl)pyrimidin-2-yl]benzene-1,3,5-tricarbonitrile |
| SMILES | CCCCCCCCc1cc(-c2cc(-c3cc4sc(C)cc4s3)nc(-c3c(C#N)cc(C#N)cc3C#N)n2)c(CCCCCCCC)cc1C |
| InChI | InChI=1S/C43H47N5S2/c1-5-7-9-11-13-15-17-32-23-36(33(19-29(32)3)18-16-14-12-10-8-6-2)37-24-38(39-25-41-40(50-39)20-30(4)49-41)48-43(47-37)42-34(27-45)21-31(26-44)22-35(42)28-46/h19-25H,5-18H2,1-4H3 |
| InChIKey | AXJJMWDOOWVAKK-UHFFFAOYSA-N |
| XLogP | 12.79 |
| TPSA | 97.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.02 |
| LogP ≤ 5 | 12.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|