C20H26O4 — CID 11834636
6-tert-butyl-5-(2,2-dimethylpropanoyl)-2-methyl-2-phenyl-1,3-dioxin-4-one (PubChem CID 11834636) has the molecular formula C20H26O4 and a molecular weight of 330.42 g/mol. Its IUPAC name is 6-tert-butyl-5-(2,2-dimethylpropanoyl)-2-methyl-2-phenyl-1,3-dioxin-4-one.
| Compound Name | 6-tert-butyl-5-(2,2-dimethylpropanoyl)-2-methyl-2-phenyl-1,3-dioxin-4-one |
|---|---|
| PubChem CID | 11834636 |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 6-tert-butyl-5-(2,2-dimethylpropanoyl)-2-methyl-2-phenyl-1,3-dioxin-4-one |
| SMILES | CC(C)(C)C(=O)C1=C(C(C)(C)C)OC(C)(c2ccccc2)OC1=O |
| InChI | InChI=1S/C20H26O4/c1-18(2,3)15(21)14-16(19(4,5)6)23-20(7,24-17(14)22)13-11-9-8-10-12-13/h8-12H,1-7H3 |
| InChIKey | QSQGXJKMYBNWGN-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|