C25H29NO3 — CID 11811242
6-tert-butyl-5-(2,2-dimethylpropanoyl)-2,3-diphenyl-2H-1,3-oxazin-4-one (PubChem CID 11811242) has the molecular formula C25H29NO3 and a molecular weight of 391.51 g/mol. Its IUPAC name is 6-tert-butyl-5-(2,2-dimethylpropanoyl)-2,3-diphenyl-2H-1,3-oxazin-4-one.
| Compound Name | 6-tert-butyl-5-(2,2-dimethylpropanoyl)-2,3-diphenyl-2H-1,3-oxazin-4-one |
|---|---|
| PubChem CID | 11811242 |
| Molecular Formula | C25H29NO3 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | 6-tert-butyl-5-(2,2-dimethylpropanoyl)-2,3-diphenyl-2H-1,3-oxazin-4-one |
| SMILES | CC(C)(C)C(=O)C1=C(C(C)(C)C)OC(c2ccccc2)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C25H29NO3/c1-24(2,3)20(27)19-21(25(4,5)6)29-23(17-13-9-7-10-14-17)26(22(19)28)18-15-11-8-12-16-18/h7-16,23H,1-6H3 |
| InChIKey | IYZWRSIMOOJHBU-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|