About 6-(4-methylphenyl)-2,3-diphenyl-2H-1,3-oxazin-4-one
6-(4-methylphenyl)-2,3-diphenyl-2H-1,3-oxazin-4-one (PubChem CID 15570593) has the molecular formula C23H19NO2
and a molecular weight of 341.41 g/mol. Its IUPAC name is 6-(4-methylphenyl)-2,3-diphenyl-2H-1,3-oxazin-4-one.
Molecular Properties
| Compound Name | 6-(4-methylphenyl)-2,3-diphenyl-2H-1,3-oxazin-4-one |
| PubChem CID | 15570593 |
| Molecular Formula | C23H19NO2 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 6-(4-methylphenyl)-2,3-diphenyl-2H-1,3-oxazin-4-one |
| SMILES | Cc1ccc(C2=CC(=O)N(c3ccccc3)C(c3ccccc3)O2)cc1 |
| InChI | InChI=1S/C23H19NO2/c1-17-12-14-18(15-13-17)21-16-22(25)24(20-10-6-3-7-11-20)23(26-21)19-8-4-2-5-9-19/h2-16,23H,1H3 |
| InChIKey | MLZYLQFRDVSOLF-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-(4-methylphenyl)-2,3-diphenyl-2H-1,3-oxazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-methylphenyl)-2,3-diphenyl-2H-1,3-oxazin-4-one?
The IUPAC name of 6-(4-methylphenyl)-2,3-diphenyl-2H-1,3-oxazin-4-one (CID 15570593) is 6-(4-methylphenyl)-2,3-diphenyl-2H-1,3-oxazin-4-one.
What is the SMILES notation for 6-(4-methylphenyl)-2,3-diphenyl-2H-1,3-oxazin-4-one?
The canonical SMILES for 6-(4-methylphenyl)-2,3-diphenyl-2H-1,3-oxazin-4-one is Cc1ccc(C2=CC(=O)N(c3ccccc3)C(c3ccccc3)O2)cc1.
What is the InChIKey of 6-(4-methylphenyl)-2,3-diphenyl-2H-1,3-oxazin-4-one?
The InChIKey is MLZYLQFRDVSOLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19NO2/c1-17-12-14-18(15-13-17)21-16-22(25)24(20-10-6-3-7-11-20)23(26-21)19-8-4-2-5-9-19/h2-16,23H,1H3.
What are the key properties of 6-(4-methylphenyl)-2,3-diphenyl-2H-1,3-oxazin-4-one?
6-(4-methylphenyl)-2,3-diphenyl-2H-1,3-oxazin-4-one has a molecular weight of 341.41 g/mol, XLogP of 5.10, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-methylphenyl)-2,3-diphenyl-2H-1,3-oxazin-4-one is sourced from PubChem (CID 15570593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).