C16H18N6O2 — CID 11834742
(1E)-1-[amino(nitramido)methylidene]-2,3-bis(4-methylphenyl)guanidine (PubChem CID 11834742) has the molecular formula C16H18N6O2 and a molecular weight of 326.36 g/mol. Its IUPAC name is (1E)-1-[amino(nitramido)methylidene]-2,3-bis(4-methylphenyl)guanidine.
| Compound Name | (1E)-1-[amino(nitramido)methylidene]-2,3-bis(4-methylphenyl)guanidine |
|---|---|
| PubChem CID | 11834742 |
| Molecular Formula | C16H18N6O2 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | (1E)-1-[amino(nitramido)methylidene]-2,3-bis(4-methylphenyl)guanidine |
| SMILES | Cc1ccc(/N=C(\N=C(/N)N[N+](=O)[O-])Nc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C16H18N6O2/c1-11-3-7-13(8-4-11)18-16(20-15(17)21-22(23)24)19-14-9-5-12(2)6-10-14/h3-10H,1-2H3,(H4,17,18,19,20,21) |
| InChIKey | SBGLPRPTUYMWJH-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|