C16H17NO3S — CID 118351993
4-ethenyl-6-(oxolan-2-ylmethylsulfonyl)quinoline (PubChem CID 118351993) has the molecular formula C16H17NO3S and a molecular weight of 303.38 g/mol. Its IUPAC name is 4-ethenyl-6-(oxolan-2-ylmethylsulfonyl)quinoline.
| Compound Name | 4-ethenyl-6-(oxolan-2-ylmethylsulfonyl)quinoline |
|---|---|
| PubChem CID | 118351993 |
| Molecular Formula | C16H17NO3S |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 4-ethenyl-6-(oxolan-2-ylmethylsulfonyl)quinoline |
| SMILES | C=Cc1ccnc2ccc(S(=O)(=O)CC3CCCO3)cc12 |
| InChI | InChI=1S/C16H17NO3S/c1-2-12-7-8-17-16-6-5-14(10-15(12)16)21(18,19)11-13-4-3-9-20-13/h2,5-8,10,13H,1,3-4,9,11H2 |
| InChIKey | WWVAKWOFYPZBGV-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |