C16H34N5O5P — CID 118362398
2-[[(2S)-5-(carbamoylamino)-2-[[(2S)-3-methyl-2-(methylamino)pentanoyl]amino]pentanoyl]amino]ethyl-methylphosphinic acid (PubChem CID 118362398) has the molecular formula C16H34N5O5P and a molecular weight of 407.45 g/mol. Its IUPAC name is 2-[[(2S)-5-(carbamoylamino)-2-[[(2S)-3-methyl-2-(methylamino)pentanoyl]amino]pentanoyl]amino]ethyl-methylphosphinic acid.
| Compound Name | 2-[[(2S)-5-(carbamoylamino)-2-[[(2S)-3-methyl-2-(methylamino)pentanoyl]amino]pentanoyl]amino]ethyl-methylphosphinic acid |
|---|---|
| PubChem CID | 118362398 |
| Molecular Formula | C16H34N5O5P |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | 2-[[(2S)-5-(carbamoylamino)-2-[[(2S)-3-methyl-2-(methylamino)pentanoyl]amino]pentanoyl]amino]ethyl-methylphosphinic acid |
| SMILES | CCC(C)[C@H](NC)C(=O)N[C@@H](CCCNC(N)=O)C(=O)NCCP(C)(=O)O |
| InChI | InChI=1S/C16H34N5O5P/c1-5-11(2)13(18-3)15(23)21-12(7-6-8-20-16(17)24)14(22)19-9-10-27(4,25)26/h11-13,18H,5-10H2,1-4H3,(H,19,22)(H,21,23)(H,25,26)(H3,17,20,24)/t11?,12-,13-/m0/s1 |
| InChIKey | RQRUTSYOPUAIIL-SPOOISQMSA-N |
| XLogP | -0.43 |
| TPSA | 162.65 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|