C7H14O4 — CID 118364923
1-(1,3-dioxolan-4-yl)-1-methoxypropan-2-ol (PubChem CID 118364923) has the molecular formula C7H14O4 and a molecular weight of 162.18 g/mol. Its IUPAC name is 1-(1,3-dioxolan-4-yl)-1-methoxypropan-2-ol.
| Compound Name | 1-(1,3-dioxolan-4-yl)-1-methoxypropan-2-ol |
|---|---|
| PubChem CID | 118364923 |
| Molecular Formula | C7H14O4 |
| Molecular Weight | 162.18 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 1-(1,3-dioxolan-4-yl)-1-methoxypropan-2-ol |
| SMILES | COC(C(C)O)C1COCO1 |
| InChI | InChI=1S/C7H14O4/c1-5(8)7(9-2)6-3-10-4-11-6/h5-8H,3-4H2,1-2H3 |
| InChIKey | CKVPNQJIIIFOND-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.18 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |