C30H33N3O3 — CID 118367744
(E)-3-[3-[[1-[[5-[4-(dimethylamino)phenyl]-2-pyridinyl]methyl]cyclohexyl]-formylamino]phenyl]prop-2-enoic acid (PubChem CID 118367744) has the molecular formula C30H33N3O3 and a molecular weight of 483.61 g/mol. Its IUPAC name is (E)-3-[3-[[1-[[5-[4-(dimethylamino)phenyl]-2-pyridinyl]methyl]cyclohexyl]-formylamino]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-[[1-[[5-[4-(dimethylamino)phenyl]-2-pyridinyl]methyl]cyclohexyl]-formylamino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 118367744 |
| Molecular Formula | C30H33N3O3 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.25 |
| IUPAC Name | (E)-3-[3-[[1-[[5-[4-(dimethylamino)phenyl]-2-pyridinyl]methyl]cyclohexyl]-formylamino]phenyl]prop-2-enoic acid |
| SMILES | CN(C)c1ccc(-c2ccc(CC3(N(C=O)c4cccc(/C=C/C(=O)O)c4)CCCCC3)nc2)cc1 |
| InChI | InChI=1S/C30H33N3O3/c1-32(2)27-14-11-24(12-15-27)25-10-13-26(31-21-25)20-30(17-4-3-5-18-30)33(22-34)28-8-6-7-23(19-28)9-16-29(35)36/h6-16,19,21-22H,3-5,17-18,20H2,1-2H3,(H,35,36)/b16-9+ |
| InChIKey | UUKDGXDWAZOYAH-CXUHLZMHSA-N |
| XLogP | 5.82 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|