C69H62O14 — CID 118372780
1-O-benzyl 6-O-[4-oxo-2-[3-phenylmethoxy-4-[3,4,5-tris(phenylmethoxy)-6-phenylmethoxycarbonyloxan-2-yl]oxyphenyl]chromen-3-yl] hexanedioate (PubChem CID 118372780) has the molecular formula C69H62O14 and a molecular weight of 1115.24 g/mol. Its IUPAC name is 1-O-benzyl 6-O-[4-oxo-2-[3-phenylmethoxy-4-[3,4,5-tris(phenylmethoxy)-6-phenylmethoxycarbonyloxan-2-yl]oxyphenyl]chromen-3-yl] hexanedioate.
| Compound Name | 1-O-benzyl 6-O-[4-oxo-2-[3-phenylmethoxy-4-[3,4,5-tris(phenylmethoxy)-6-phenylmethoxycarbonyloxan-2-yl]oxyphenyl]chromen-3-yl] hexanedioate |
|---|---|
| PubChem CID | 118372780 |
| Molecular Formula | C69H62O14 |
| Molecular Weight | 1115.24 g/mol |
| Exact Mass | 1114.41 |
| IUPAC Name | 1-O-benzyl 6-O-[4-oxo-2-[3-phenylmethoxy-4-[3,4,5-tris(phenylmethoxy)-6-phenylmethoxycarbonyloxan-2-yl]oxyphenyl]chromen-3-yl] hexanedioate |
| SMILES | O=C(CCCCC(=O)Oc1c(-c2ccc(OC3OC(C(=O)OCc4ccccc4)C(OCc4ccccc4)C(OCc4ccccc4)C3OCc3ccccc3)c(OCc3ccccc3)c2)oc2ccccc2c1=O)OCc1ccccc1 |
| InChI | InChI=1S/C69H62O14/c70-59(75-43-49-25-9-2-10-26-49)37-21-22-38-60(71)82-63-61(72)55-35-19-20-36-56(55)80-62(63)54-39-40-57(58(41-54)74-42-48-23-7-1-8-24-48)81-69-67(78-46-52-31-15-5-16-32-52)65(77-45-51-29-13-4-14-30-51)64(76-44-50-27-11-3-12-28-50)66(83-69)68(73)79-47-53-33-17-6-18-34-53/h1-20,23-36,39-41,64-67,69H,21-22,37-38,42-47H2 |
| InChIKey | JQFKBPCLYVNEDK-UHFFFAOYSA-N |
| XLogP | 12.85 |
| TPSA | 164.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 83 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1115.24 |
| LogP ≤ 5 | 12.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|