C40H46BrNO4 — CID 70125862
8-[2-[3,4-bis(phenylmethoxy)phenyl]-4-oxochromen-3-yl]octyl-trimethylazanium bromide (PubChem CID 70125862) has the molecular formula C40H46BrNO4 and a molecular weight of 684.72 g/mol. Its IUPAC name is 8-[2-[3,4-bis(phenylmethoxy)phenyl]-4-oxochromen-3-yl]octyl-trimethylazanium bromide.
| Compound Name | 8-[2-[3,4-bis(phenylmethoxy)phenyl]-4-oxochromen-3-yl]octyl-trimethylazanium bromide |
|---|---|
| PubChem CID | 70125862 |
| Molecular Formula | C40H46BrNO4 |
| Molecular Weight | 684.72 g/mol |
| Exact Mass | 683.26 |
| IUPAC Name | 8-[2-[3,4-bis(phenylmethoxy)phenyl]-4-oxochromen-3-yl]octyl-trimethylazanium bromide |
| SMILES | C[N+](C)(C)CCCCCCCCc1c(-c2ccc(OCc3ccccc3)c(OCc3ccccc3)c2)oc2ccccc2c1=O.[Br-] |
| InChI | InChI=1S/C40H46NO4.BrH/c1-41(2,3)27-17-7-5-4-6-14-23-35-39(42)34-22-15-16-24-36(34)45-40(35)33-25-26-37(43-29-31-18-10-8-11-19-31)38(28-33)44-30-32-20-12-9-13-21-32;/h8-13,15-16,18-22,24-26,28H,4-7,14,17,23,27,29-30H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | SQOKWMQDJHWQDW-UHFFFAOYSA-M |
| XLogP | 6.21 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.72 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|