About 1-O-benzyl 6-O-[2-(4-hydroxy-3-phenylmethoxyphenyl)-4-oxochromen-3-yl] hexanedioate;ethane
1-O-benzyl 6-O-[2-(4-hydroxy-3-phenylmethoxyphenyl)-4-oxochromen-3-yl] hexanedioate;ethane (PubChem CID 144602628) has the molecular formula C37H36O8
and a molecular weight of 608.69 g/mol. Its IUPAC name is 1-O-benzyl 6-O-[2-(4-hydroxy-3-phenylmethoxyphenyl)-4-oxochromen-3-yl] hexanedioate;ethane.
Molecular Properties
| Compound Name | 1-O-benzyl 6-O-[2-(4-hydroxy-3-phenylmethoxyphenyl)-4-oxochromen-3-yl] hexanedioate;ethane |
| PubChem CID | 144602628 |
| Molecular Formula | C37H36O8 |
| Molecular Weight | 608.69 g/mol |
| Exact Mass | 608.24 |
| IUPAC Name | 1-O-benzyl 6-O-[2-(4-hydroxy-3-phenylmethoxyphenyl)-4-oxochromen-3-yl] hexanedioate;ethane |
| SMILES | CC.O=C(CCCCC(=O)Oc1c(-c2ccc(O)c(OCc3ccccc3)c2)oc2ccccc2c1=O)OCc1ccccc1 |
| InChI | InChI=1S/C35H30O8.C2H6/c36-28-20-19-26(21-30(28)40-22-24-11-3-1-4-12-24)34-35(33(39)27-15-7-8-16-29(27)42-34)43-32(38)18-10-9-17-31(37)41-23-25-13-5-2-6-14-25;1-2/h1-8,11-16,19-21,36H,9-10,17-18,22-23H2;1-2H3 |
| InChIKey | QYTPBWAZFZPHJJ-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 112.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 608.69 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-O-benzyl 6-O-[2-(4-hydroxy-3-phenylmethoxyphenyl)-4-oxochromen-3-yl] hexanedioate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-benzyl 6-O-[2-(4-hydroxy-3-phenylmethoxyphenyl)-4-oxochromen-3-yl] hexanedioate;ethane?
The IUPAC name of 1-O-benzyl 6-O-[2-(4-hydroxy-3-phenylmethoxyphenyl)-4-oxochromen-3-yl] hexanedioate;ethane (CID 144602628) is 1-O-benzyl 6-O-[2-(4-hydroxy-3-phenylmethoxyphenyl)-4-oxochromen-3-yl] hexanedioate;ethane.
What is the SMILES notation for 1-O-benzyl 6-O-[2-(4-hydroxy-3-phenylmethoxyphenyl)-4-oxochromen-3-yl] hexanedioate;ethane?
The canonical SMILES for 1-O-benzyl 6-O-[2-(4-hydroxy-3-phenylmethoxyphenyl)-4-oxochromen-3-yl] hexanedioate;ethane is CC.O=C(CCCCC(=O)Oc1c(-c2ccc(O)c(OCc3ccccc3)c2)oc2ccccc2c1=O)OCc1ccccc1.
What is the InChIKey of 1-O-benzyl 6-O-[2-(4-hydroxy-3-phenylmethoxyphenyl)-4-oxochromen-3-yl] hexanedioate;ethane?
The InChIKey is QYTPBWAZFZPHJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C35H30O8.C2H6/c36-28-20-19-26(21-30(28)40-22-24-11-3-1-4-12-24)34-35(33(39)27-15-7-8-16-29(27)42-34)43-32(38)18-10-9-17-31(37)41-23-25-13-5-2-6-14-25;1-2/h1-8,11-16,19-21,36H,9-10,17-18,22-23H2;1-2H3.
What are the key properties of 1-O-benzyl 6-O-[2-(4-hydroxy-3-phenylmethoxyphenyl)-4-oxochromen-3-yl] hexanedioate;ethane?
1-O-benzyl 6-O-[2-(4-hydroxy-3-phenylmethoxyphenyl)-4-oxochromen-3-yl] hexanedioate;ethane has a molecular weight of 608.69 g/mol, XLogP of 7.98, 12 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-benzyl 6-O-[2-(4-hydroxy-3-phenylmethoxyphenyl)-4-oxochromen-3-yl] hexanedioate;ethane is sourced from PubChem (CID 144602628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).