C15H21ClN2O3S — CID 118374427
8-chloro-N-(3-methoxypropyl)-3,4-dimethyl-2,2-dioxo-1,5-dihydro-2λ6,1-benzothiazepin-5-amine (PubChem CID 118374427) has the molecular formula C15H21ClN2O3S and a molecular weight of 344.86 g/mol. Its IUPAC name is 8-chloro-N-(3-methoxypropyl)-3,4-dimethyl-2,2-dioxo-1,5-dihydro-2λ6,1-benzothiazepin-5-amine.
| Compound Name | 8-chloro-N-(3-methoxypropyl)-3,4-dimethyl-2,2-dioxo-1,5-dihydro-2λ6,1-benzothiazepin-5-amine |
|---|---|
| PubChem CID | 118374427 |
| Molecular Formula | C15H21ClN2O3S |
| Molecular Weight | 344.86 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 8-chloro-N-(3-methoxypropyl)-3,4-dimethyl-2,2-dioxo-1,5-dihydro-2λ6,1-benzothiazepin-5-amine |
| SMILES | COCCCNC1C(C)=C(C)S(=O)(=O)Nc2cc(Cl)ccc21 |
| InChI | InChI=1S/C15H21ClN2O3S/c1-10-11(2)22(19,20)18-14-9-12(16)5-6-13(14)15(10)17-7-4-8-21-3/h5-6,9,15,17-18H,4,7-8H2,1-3H3 |
| InChIKey | HWDNGJAAWFIVRL-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.86 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|