C23H30N2O4 — CID 118376020
[(1R,4aR,6R,8aS)-6-(6-methoxy-3-propyl-1H-indol-2-yl)-1-methyl-4a,5,6,7,8,8a-hexahydro-1H-pyrano[3,4-c]pyridin-4-yl] acetate (PubChem CID 118376020) has the molecular formula C23H30N2O4 and a molecular weight of 398.50 g/mol. Its IUPAC name is [(1R,4aR,6R,8aS)-6-(6-methoxy-3-propyl-1H-indol-2-yl)-1-methyl-4a,5,6,7,8,8a-hexahydro-1H-pyrano[3,4-c]pyridin-4-yl] acetate.
| Compound Name | [(1R,4aR,6R,8aS)-6-(6-methoxy-3-propyl-1H-indol-2-yl)-1-methyl-4a,5,6,7,8,8a-hexahydro-1H-pyrano[3,4-c]pyridin-4-yl] acetate |
|---|---|
| PubChem CID | 118376020 |
| Molecular Formula | C23H30N2O4 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | [(1R,4aR,6R,8aS)-6-(6-methoxy-3-propyl-1H-indol-2-yl)-1-methyl-4a,5,6,7,8,8a-hexahydro-1H-pyrano[3,4-c]pyridin-4-yl] acetate |
| SMILES | CCCc1c([C@H]2C[C@H]3C(OC(C)=O)=CO[C@H](C)[C@@H]3CN2)[nH]c2cc(OC)ccc12 |
| InChI | InChI=1S/C23H30N2O4/c1-5-6-17-16-8-7-15(27-4)9-20(16)25-23(17)21-10-18-19(11-24-21)13(2)28-12-22(18)29-14(3)26/h7-9,12-13,18-19,21,24-25H,5-6,10-11H2,1-4H3/t13-,18-,19+,21-/m1/s1 |
| InChIKey | QDYXJIMPSRVJMV-BAXCTAAUSA-N |
| XLogP | 4.22 |
| TPSA | 72.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|