C23H30N2O4 — CID 118376032
methyl (1S,4aS,6S,8aS)-6-(6-methoxy-3-propyl-1H-indol-2-yl)-1-methyl-4a,5,6,7,8,8a-hexahydro-1H-pyrano[3,4-c]pyridine-4-carboxylate (PubChem CID 118376032) has the molecular formula C23H30N2O4 and a molecular weight of 398.50 g/mol. Its IUPAC name is methyl (1S,4aS,6S,8aS)-6-(6-methoxy-3-propyl-1H-indol-2-yl)-1-methyl-4a,5,6,7,8,8a-hexahydro-1H-pyrano[3,4-c]pyridine-4-carboxylate.
| Compound Name | methyl (1S,4aS,6S,8aS)-6-(6-methoxy-3-propyl-1H-indol-2-yl)-1-methyl-4a,5,6,7,8,8a-hexahydro-1H-pyrano[3,4-c]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 118376032 |
| Molecular Formula | C23H30N2O4 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | methyl (1S,4aS,6S,8aS)-6-(6-methoxy-3-propyl-1H-indol-2-yl)-1-methyl-4a,5,6,7,8,8a-hexahydro-1H-pyrano[3,4-c]pyridine-4-carboxylate |
| SMILES | CCCc1c([C@@H]2C[C@@H]3C(C(=O)OC)=CO[C@@H](C)[C@@H]3CN2)[nH]c2cc(OC)ccc12 |
| InChI | InChI=1S/C23H30N2O4/c1-5-6-16-15-8-7-14(27-3)9-20(15)25-22(16)21-10-17-18(11-24-21)13(2)29-12-19(17)23(26)28-4/h7-9,12-13,17-18,21,24-25H,5-6,10-11H2,1-4H3/t13-,17-,18-,21-/m0/s1 |
| InChIKey | MHNMWONXRVVVKR-DGJUNBOTSA-N |
| XLogP | 3.87 |
| TPSA | 72.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|