C24H32N2O5 — CID 118376035
methyl (1S,4aS,6S,8aS)-6-(5,6-dimethoxy-3-propyl-1H-indol-2-yl)-1-methyl-4a,5,6,7,8,8a-hexahydro-1H-pyrano[3,4-c]pyridine-4-carboxylate (PubChem CID 118376035) has the molecular formula C24H32N2O5 and a molecular weight of 428.53 g/mol. Its IUPAC name is methyl (1S,4aS,6S,8aS)-6-(5,6-dimethoxy-3-propyl-1H-indol-2-yl)-1-methyl-4a,5,6,7,8,8a-hexahydro-1H-pyrano[3,4-c]pyridine-4-carboxylate.
| Compound Name | methyl (1S,4aS,6S,8aS)-6-(5,6-dimethoxy-3-propyl-1H-indol-2-yl)-1-methyl-4a,5,6,7,8,8a-hexahydro-1H-pyrano[3,4-c]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 118376035 |
| Molecular Formula | C24H32N2O5 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | methyl (1S,4aS,6S,8aS)-6-(5,6-dimethoxy-3-propyl-1H-indol-2-yl)-1-methyl-4a,5,6,7,8,8a-hexahydro-1H-pyrano[3,4-c]pyridine-4-carboxylate |
| SMILES | CCCc1c([C@@H]2C[C@@H]3C(C(=O)OC)=CO[C@@H](C)[C@@H]3CN2)[nH]c2cc(OC)c(OC)cc12 |
| InChI | InChI=1S/C24H32N2O5/c1-6-7-14-16-9-21(28-3)22(29-4)10-19(16)26-23(14)20-8-15-17(11-25-20)13(2)31-12-18(15)24(27)30-5/h9-10,12-13,15,17,20,25-26H,6-8,11H2,1-5H3/t13-,15-,17-,20-/m0/s1 |
| InChIKey | DEAWXDRHVJGKSZ-GGLFYADGSA-N |
| XLogP | 3.88 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|