C19H15F5N4O — CID 118378709
N-[5-[3-ethyl-3-(trifluoromethyl)cyclohexa-1,4-dien-1-yl]pyrazin-2-yl]-3,5-difluoropyridine-4-carboxamide (PubChem CID 118378709) has the molecular formula C19H15F5N4O and a molecular weight of 410.35 g/mol. Its IUPAC name is N-[5-[3-ethyl-3-(trifluoromethyl)cyclohexa-1,4-dien-1-yl]pyrazin-2-yl]-3,5-difluoropyridine-4-carboxamide.
| Compound Name | N-[5-[3-ethyl-3-(trifluoromethyl)cyclohexa-1,4-dien-1-yl]pyrazin-2-yl]-3,5-difluoropyridine-4-carboxamide |
|---|---|
| PubChem CID | 118378709 |
| Molecular Formula | C19H15F5N4O |
| Molecular Weight | 410.35 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | N-[5-[3-ethyl-3-(trifluoromethyl)cyclohexa-1,4-dien-1-yl]pyrazin-2-yl]-3,5-difluoropyridine-4-carboxamide |
| SMILES | CCC1(C(F)(F)F)C=CCC(c2cnc(NC(=O)c3c(F)cncc3F)cn2)=C1 |
| InChI | InChI=1S/C19H15F5N4O/c1-2-18(19(22,23)24)5-3-4-11(6-18)14-9-27-15(10-26-14)28-17(29)16-12(20)7-25-8-13(16)21/h3,5-10H,2,4H2,1H3,(H,27,28,29) |
| InChIKey | UXJVSGPJFVYLTH-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.35 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|