C10H14N4O3 — CID 11838398
1-hydroxy-2-[(E)-2-(4-methoxyphenoxy)ethylideneamino]guanidine (PubChem CID 11838398) has the molecular formula C10H14N4O3 and a molecular weight of 238.25 g/mol. Its IUPAC name is 1-hydroxy-2-[(E)-2-(4-methoxyphenoxy)ethylideneamino]guanidine.
| Compound Name | 1-hydroxy-2-[(E)-2-(4-methoxyphenoxy)ethylideneamino]guanidine |
|---|---|
| PubChem CID | 11838398 |
| Molecular Formula | C10H14N4O3 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 1-hydroxy-2-[(E)-2-(4-methoxyphenoxy)ethylideneamino]guanidine |
| SMILES | COc1ccc(OC/C=N/N=C(\N)NO)cc1 |
| InChI | InChI=1S/C10H14N4O3/c1-16-8-2-4-9(5-3-8)17-7-6-12-13-10(11)14-15/h2-6,15H,7H2,1H3,(H3,11,13,14)/b12-6+ |
| InChIKey | MUGKFNMEUSQIGS-WUXMJOGZSA-N |
| XLogP | 0.35 |
| TPSA | 101.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|