C11H16N4O2 — CID 14816037
2-[(E)-2-(2,4-dimethylphenoxy)ethylideneamino]-1-hydroxyguanidine (PubChem CID 14816037) has the molecular formula C11H16N4O2 and a molecular weight of 236.28 g/mol. Its IUPAC name is 2-[(E)-2-(2,4-dimethylphenoxy)ethylideneamino]-1-hydroxyguanidine.
| Compound Name | 2-[(E)-2-(2,4-dimethylphenoxy)ethylideneamino]-1-hydroxyguanidine |
|---|---|
| PubChem CID | 14816037 |
| Molecular Formula | C11H16N4O2 |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 2-[(E)-2-(2,4-dimethylphenoxy)ethylideneamino]-1-hydroxyguanidine |
| SMILES | Cc1ccc(OC/C=N/N=C(\N)NO)c(C)c1 |
| InChI | InChI=1S/C11H16N4O2/c1-8-3-4-10(9(2)7-8)17-6-5-13-14-11(12)15-16/h3-5,7,16H,6H2,1-2H3,(H3,12,14,15)/b13-5+ |
| InChIKey | AQYZDVQPYNAASN-WLRTZDKTSA-N |
| XLogP | 0.96 |
| TPSA | 92.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|