C22H34N8O8S — CID 172886870
bis(2-[(E)-2-(2,4-dimethylphenoxy)ethylideneamino]-1-hydroxyguanidine);sulfuric acid (PubChem CID 172886870) has the molecular formula C22H34N8O8S and a molecular weight of 570.63 g/mol. Its IUPAC name is bis(2-[(E)-2-(2,4-dimethylphenoxy)ethylideneamino]-1-hydroxyguanidine);sulfuric acid.
| Compound Name | bis(2-[(E)-2-(2,4-dimethylphenoxy)ethylideneamino]-1-hydroxyguanidine);sulfuric acid |
|---|---|
| PubChem CID | 172886870 |
| Molecular Formula | C22H34N8O8S |
| Molecular Weight | 570.63 g/mol |
| Exact Mass | 570.22 |
| IUPAC Name | bis(2-[(E)-2-(2,4-dimethylphenoxy)ethylideneamino]-1-hydroxyguanidine);sulfuric acid |
| SMILES | Cc1ccc(OC/C=N/N=C(\N)NO)c(C)c1.Cc1ccc(OC/C=N/N=C(\N)NO)c(C)c1.O=S(=O)(O)O |
| InChI | InChI=1S/2C11H16N4O2.H2O4S/c2*1-8-3-4-10(9(2)7-8)17-6-5-13-14-11(12)15-16;1-5(2,3)4/h2*3-5,7,16H,6H2,1-2H3,(H3,12,14,15);(H2,1,2,3,4)/b2*13-5+; |
| InChIKey | XCNOFPCIJIEQLQ-ZPYWNHNTSA-N |
| XLogP | 1.27 |
| TPSA | 259.06 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.63 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|