C13H7F15N2O2S3 — CID 118391999
3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-pentadecafluorononyl 2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]acetate (PubChem CID 118391999) has the molecular formula C13H7F15N2O2S3 and a molecular weight of 604.38 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-pentadecafluorononyl 2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]acetate.
| Compound Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-pentadecafluorononyl 2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]acetate |
|---|---|
| PubChem CID | 118391999 |
| Molecular Formula | C13H7F15N2O2S3 |
| Molecular Weight | 604.38 g/mol |
| Exact Mass | 603.94 |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-pentadecafluorononyl 2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]acetate |
| SMILES | O=C(CSc1n[nH]c(=S)s1)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H7F15N2O2S3/c14-7(15,1-2-32-4(31)3-34-6-30-29-5(33)35-6)8(16,17)9(18,19)10(20,21)11(22,23)12(24,25)13(26,27)28/h1-3H2,(H,29,33) |
| InChIKey | HJVUOCHIEZFJGE-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.38 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|