C22H24N4O — CID 118400001
3-(3,3-dimethylbut-1-ynyl)-1-ethyl-7-[(5-methyl-2-pyridinyl)amino]-1,6-naphthyridin-2-one (PubChem CID 118400001) has the molecular formula C22H24N4O and a molecular weight of 360.46 g/mol. Its IUPAC name is 3-(3,3-dimethylbut-1-ynyl)-1-ethyl-7-[(5-methyl-2-pyridinyl)amino]-1,6-naphthyridin-2-one.
| Compound Name | 3-(3,3-dimethylbut-1-ynyl)-1-ethyl-7-[(5-methyl-2-pyridinyl)amino]-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 118400001 |
| Molecular Formula | C22H24N4O |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 3-(3,3-dimethylbut-1-ynyl)-1-ethyl-7-[(5-methyl-2-pyridinyl)amino]-1,6-naphthyridin-2-one |
| SMILES | CCn1c(=O)c(C#CC(C)(C)C)cc2cnc(Nc3ccc(C)cn3)cc21 |
| InChI | InChI=1S/C22H24N4O/c1-6-26-18-12-20(25-19-8-7-15(2)13-23-19)24-14-17(18)11-16(21(26)27)9-10-22(3,4)5/h7-8,11-14H,6H2,1-5H3,(H,23,24,25) |
| InChIKey | MTJSQDDALLJKDO-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|