C22H26N4OSi — CID 123464495
1-ethyl-7-[(5-methyl-2-pyridinyl)amino]-3-(3-trimethylsilylprop-1-ynyl)-1,6-naphthyridin-2-one (PubChem CID 123464495) has the molecular formula C22H26N4OSi and a molecular weight of 390.56 g/mol. Its IUPAC name is 1-ethyl-7-[(5-methyl-2-pyridinyl)amino]-3-(3-trimethylsilylprop-1-ynyl)-1,6-naphthyridin-2-one.
| Compound Name | 1-ethyl-7-[(5-methyl-2-pyridinyl)amino]-3-(3-trimethylsilylprop-1-ynyl)-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 123464495 |
| Molecular Formula | C22H26N4OSi |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 1-ethyl-7-[(5-methyl-2-pyridinyl)amino]-3-(3-trimethylsilylprop-1-ynyl)-1,6-naphthyridin-2-one |
| SMILES | CCn1c(=O)c(C#CC[Si](C)(C)C)cc2cnc(Nc3ccc(C)cn3)cc21 |
| InChI | InChI=1S/C22H26N4OSi/c1-6-26-19-13-21(25-20-10-9-16(2)14-23-20)24-15-18(19)12-17(22(26)27)8-7-11-28(3,4)5/h9-10,12-15H,6,11H2,1-5H3,(H,23,24,25) |
| InChIKey | PEXLFWSWVAXCJD-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|