C49H95NO6 — CID 118403733
3-butylheptyl 10-[2-[8-(3-butylheptoxy)-8-oxooctyl]-4-[2-[methyl(propan-2-yl)amino]ethyl]-1,3-dioxolan-2-yl]decanoate (PubChem CID 118403733) has the molecular formula C49H95NO6 and a molecular weight of 794.30 g/mol. Its IUPAC name is 3-butylheptyl 10-[2-[8-(3-butylheptoxy)-8-oxooctyl]-4-[2-[methyl(propan-2-yl)amino]ethyl]-1,3-dioxolan-2-yl]decanoate.
| Compound Name | 3-butylheptyl 10-[2-[8-(3-butylheptoxy)-8-oxooctyl]-4-[2-[methyl(propan-2-yl)amino]ethyl]-1,3-dioxolan-2-yl]decanoate |
|---|---|
| PubChem CID | 118403733 |
| Molecular Formula | C49H95NO6 |
| Molecular Weight | 794.30 g/mol |
| Exact Mass | 793.72 |
| IUPAC Name | 3-butylheptyl 10-[2-[8-(3-butylheptoxy)-8-oxooctyl]-4-[2-[methyl(propan-2-yl)amino]ethyl]-1,3-dioxolan-2-yl]decanoate |
| SMILES | CCCCC(CCCC)CCOC(=O)CCCCCCCCCC1(CCCCCCCC(=O)OCCC(CCCC)CCCC)OCC(CCN(C)C(C)C)O1 |
| InChI | InChI=1S/C49H95NO6/c1-8-12-28-44(29-13-9-2)35-40-53-47(51)32-24-20-17-16-18-22-26-37-49(55-42-46(56-49)34-39-50(7)43(5)6)38-27-23-19-21-25-33-48(52)54-41-36-45(30-14-10-3)31-15-11-4/h43-46H,8-42H2,1-7H3 |
| InChIKey | XUULLTGGBHGQPZ-UHFFFAOYSA-N |
| XLogP | 13.93 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.30 |
| LogP ≤ 5 | 13.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|