C49H91NO8S — CID 169169913
4-(2-hexyl-2-nonyl-1,3-dioxolan-4-yl)butyl 2-[[2-[4-(2-hexyl-2-nonyl-1,3-dioxolan-4-yl)butoxy]-2-oxoethyl]-methanethioylamino]acetate (PubChem CID 169169913) has the molecular formula C49H91NO8S and a molecular weight of 854.33 g/mol. Its IUPAC name is 4-(2-hexyl-2-nonyl-1,3-dioxolan-4-yl)butyl 2-[[2-[4-(2-hexyl-2-nonyl-1,3-dioxolan-4-yl)butoxy]-2-oxoethyl]-methanethioylamino]acetate.
| Compound Name | 4-(2-hexyl-2-nonyl-1,3-dioxolan-4-yl)butyl 2-[[2-[4-(2-hexyl-2-nonyl-1,3-dioxolan-4-yl)butoxy]-2-oxoethyl]-methanethioylamino]acetate |
|---|---|
| PubChem CID | 169169913 |
| Molecular Formula | C49H91NO8S |
| Molecular Weight | 854.33 g/mol |
| Exact Mass | 853.65 |
| IUPAC Name | 4-(2-hexyl-2-nonyl-1,3-dioxolan-4-yl)butyl 2-[[2-[4-(2-hexyl-2-nonyl-1,3-dioxolan-4-yl)butoxy]-2-oxoethyl]-methanethioylamino]acetate |
| SMILES | CCCCCCCCCC1(CCCCCC)OCC(CCCCOC(=O)CN(C=S)CC(=O)OCCCCC2COC(CCCCCC)(CCCCCCCCC)O2)O1 |
| InChI | InChI=1S/C49H91NO8S/c1-5-9-13-17-19-21-27-35-48(33-25-15-11-7-3)55-41-44(57-48)31-23-29-37-53-46(51)39-50(43-59)40-47(52)54-38-30-24-32-45-42-56-49(58-45,34-26-16-12-8-4)36-28-22-20-18-14-10-6-2/h43-45H,5-42H2,1-4H3 |
| InChIKey | DHSRESBNZUCEGW-UHFFFAOYSA-N |
| XLogP | 13.12 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 854.33 |
| LogP ≤ 5 | 13.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|