C49H96N2O6 — CID 123649068
8-[4-[[2-(methylamino)ethylamino]methyl]-2-[8-(3-pentyloctanoyloxy)octyl]-1,3-dioxolan-2-yl]octyl 3-pentyloctanoate (PubChem CID 123649068) has the molecular formula C49H96N2O6 and a molecular weight of 809.31 g/mol. Its IUPAC name is 8-[4-[[2-(methylamino)ethylamino]methyl]-2-[8-(3-pentyloctanoyloxy)octyl]-1,3-dioxolan-2-yl]octyl 3-pentyloctanoate.
| Compound Name | 8-[4-[[2-(methylamino)ethylamino]methyl]-2-[8-(3-pentyloctanoyloxy)octyl]-1,3-dioxolan-2-yl]octyl 3-pentyloctanoate |
|---|---|
| PubChem CID | 123649068 |
| Molecular Formula | C49H96N2O6 |
| Molecular Weight | 809.31 g/mol |
| Exact Mass | 808.73 |
| IUPAC Name | 8-[4-[[2-(methylamino)ethylamino]methyl]-2-[8-(3-pentyloctanoyloxy)octyl]-1,3-dioxolan-2-yl]octyl 3-pentyloctanoate |
| SMILES | CCCCCC(CCCCC)CC(=O)OCCCCCCCCC1(CCCCCCCCOC(=O)CC(CCCCC)CCCCC)OCC(CNCCNC)O1 |
| InChI | InChI=1S/C49H96N2O6/c1-6-10-22-30-44(31-23-11-7-2)40-47(52)54-38-28-20-16-14-18-26-34-49(56-43-46(57-49)42-51-37-36-50-5)35-27-19-15-17-21-29-39-55-48(53)41-45(32-24-12-8-3)33-25-13-9-4/h44-46,50-51H,6-43H2,1-5H3 |
| InChIKey | QDFDOODJUNVTBI-UHFFFAOYSA-N |
| XLogP | 12.79 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.31 |
| LogP ≤ 5 | 12.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|