C51H103NO6 — CID 144641566
8-[4-ethyl-2-(10-pentylpentadecyl)-1,3-dioxolan-2-yl]octyl 3-pentyloctanoate;formic acid;N-methylpropan-2-amine (PubChem CID 144641566) has the molecular formula C51H103NO6 and a molecular weight of 826.39 g/mol. Its IUPAC name is 8-[4-ethyl-2-(10-pentylpentadecyl)-1,3-dioxolan-2-yl]octyl 3-pentyloctanoate;formic acid;N-methylpropan-2-amine.
| Compound Name | 8-[4-ethyl-2-(10-pentylpentadecyl)-1,3-dioxolan-2-yl]octyl 3-pentyloctanoate;formic acid;N-methylpropan-2-amine |
|---|---|
| PubChem CID | 144641566 |
| Molecular Formula | C51H103NO6 |
| Molecular Weight | 826.39 g/mol |
| Exact Mass | 825.78 |
| IUPAC Name | 8-[4-ethyl-2-(10-pentylpentadecyl)-1,3-dioxolan-2-yl]octyl 3-pentyloctanoate;formic acid;N-methylpropan-2-amine |
| SMILES | CCCCCC(CCCCC)CCCCCCCCCC1(CCCCCCCCOC(=O)CC(CCCCC)CCCCC)OCC(CC)O1.CNC(C)C.O=CO |
| InChI | InChI=1S/C46H90O4.C4H11N.CH2O2/c1-6-11-24-32-42(33-25-12-7-2)34-28-20-16-15-17-21-29-37-46(49-41-44(10-5)50-46)38-30-22-18-19-23-31-39-48-45(47)40-43(35-26-13-8-3)36-27-14-9-4;1-4(2)5-3;2-1-3/h42-44H,6-41H2,1-5H3;4-5H,1-3H3;1H,(H,2,3) |
| InChIKey | ACNWLBJNSPOZCI-UHFFFAOYSA-N |
| XLogP | 15.55 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.39 |
| LogP ≤ 5 | 15.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|