C28H34O5S — CID 118406236
1-[4-(6,7-dimethoxynaphthalen-2-yl)oxyphenyl]-2-(2-ethoxyethylsulfanyl)-3,3-dimethylbutan-1-one (PubChem CID 118406236) has the molecular formula C28H34O5S and a molecular weight of 482.64 g/mol. Its IUPAC name is 1-[4-(6,7-dimethoxynaphthalen-2-yl)oxyphenyl]-2-(2-ethoxyethylsulfanyl)-3,3-dimethylbutan-1-one.
| Compound Name | 1-[4-(6,7-dimethoxynaphthalen-2-yl)oxyphenyl]-2-(2-ethoxyethylsulfanyl)-3,3-dimethylbutan-1-one |
|---|---|
| PubChem CID | 118406236 |
| Molecular Formula | C28H34O5S |
| Molecular Weight | 482.64 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | 1-[4-(6,7-dimethoxynaphthalen-2-yl)oxyphenyl]-2-(2-ethoxyethylsulfanyl)-3,3-dimethylbutan-1-one |
| SMILES | CCOCCSC(C(=O)c1ccc(Oc2ccc3cc(OC)c(OC)cc3c2)cc1)C(C)(C)C |
| InChI | InChI=1S/C28H34O5S/c1-7-32-14-15-34-27(28(2,3)4)26(29)19-8-11-22(12-9-19)33-23-13-10-20-17-24(30-5)25(31-6)18-21(20)16-23/h8-13,16-18,27H,7,14-15H2,1-6H3 |
| InChIKey | FKWUDWZDMUHWHZ-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.64 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|